C32H28N4O9S4 — CID 90323461
4-nitrooxybutyl 4-[5-methyl-2-(4-sulfamoylphenyl)pyrazol-3-yl]-2-[2-[4-(5-sulfanylidenedithiol-3-yl)phenyl]acetyl]oxybenzoate (PubChem CID 90323461) has the molecular formula C32H28N4O9S4 and a molecular weight of 740.86 g/mol. Its IUPAC name is 4-nitrooxybutyl 4-[5-methyl-2-(4-sulfamoylphenyl)pyrazol-3-yl]-2-[2-[4-(5-sulfanylidenedithiol-3-yl)phenyl]acetyl]oxybenzoate.
| Compound Name | 4-nitrooxybutyl 4-[5-methyl-2-(4-sulfamoylphenyl)pyrazol-3-yl]-2-[2-[4-(5-sulfanylidenedithiol-3-yl)phenyl]acetyl]oxybenzoate |
|---|---|
| PubChem CID | 90323461 |
| Molecular Formula | C32H28N4O9S4 |
| Molecular Weight | 740.86 g/mol |
| Exact Mass | 740.07 |
| IUPAC Name | 4-nitrooxybutyl 4-[5-methyl-2-(4-sulfamoylphenyl)pyrazol-3-yl]-2-[2-[4-(5-sulfanylidenedithiol-3-yl)phenyl]acetyl]oxybenzoate |
| SMILES | Cc1cc(-c2ccc(C(=O)OCCCCO[N+](=O)[O-])c(OC(=O)Cc3ccc(-c4cc(=S)ss4)cc3)c2)n(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C32H28N4O9S4/c1-20-16-27(35(34-20)24-9-11-25(12-10-24)49(33,41)42)23-8-13-26(32(38)43-14-2-3-15-44-36(39)40)28(18-23)45-30(37)17-21-4-6-22(7-5-21)29-19-31(46)48-47-29/h4-13,16,18-19H,2-3,14-15,17H2,1H3,(H2,33,41,42) |
| InChIKey | HKMFXESOELSGOI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 182.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.86 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|