C20H22N4O6S — CID 68818610
3-[[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]propyl nitrate (PubChem CID 68818610) has the molecular formula C20H22N4O6S and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-[[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]propyl nitrate.
| Compound Name | 3-[[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]propyl nitrate |
|---|---|
| PubChem CID | 68818610 |
| Molecular Formula | C20H22N4O6S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-[[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]propyl nitrate |
| SMILES | Cc1ccc(-c2cc(COCCCO[N+](=O)[O-])nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O6S/c1-15-3-5-16(6-4-15)20-13-17(14-29-11-2-12-30-24(25)26)22-23(20)18-7-9-19(10-8-18)31(21,27)28/h3-10,13H,2,11-12,14H2,1H3,(H2,21,27,28) |
| InChIKey | BMVYBQGKMWDCSX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|