C29H42Cl2FN5O4S3 — CID 169005983
2-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl-(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide;dihydrochloride (PubChem CID 169005983) has the molecular formula C29H42Cl2FN5O4S3 and a molecular weight of 710.79 g/mol. Its IUPAC name is 2-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl-(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide;dihydrochloride.
| Compound Name | 2-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl-(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 169005983 |
| Molecular Formula | C29H42Cl2FN5O4S3 |
| Molecular Weight | 710.79 g/mol |
| Exact Mass | 709.18 |
| IUPAC Name | 2-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl-(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.NS(=O)(=O)c1ccc(-n2nc(COCCCCCCCN(CCS)CC(=O)NCCS)cc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H40FN5O4S3.2ClH/c30-24-8-6-23(7-9-24)28-20-25(33-35(28)26-10-12-27(13-11-26)42(31,37)38)22-39-17-5-3-1-2-4-15-34(16-19-41)21-29(36)32-14-18-40;;/h6-13,20,40-41H,1-5,14-19,21-22H2,(H,32,36)(H2,31,37,38);2*1H |
| InChIKey | FIWWIKHYRJAYOP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.79 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|