C36H50N8O6S2 — CID 163638778
4-[5-methyl-2-(4-sulfamoylphenyl)pyrazol-3-yl]-N-[10-[[2-[[2-[3-[(2-sulfanylacetyl)amino]prop-1-en-2-ylamino]acetyl]amino]acetyl]amino]decyl]benzamide (PubChem CID 163638778) has the molecular formula C36H50N8O6S2 and a molecular weight of 754.98 g/mol. Its IUPAC name is 4-[5-methyl-2-(4-sulfamoylphenyl)pyrazol-3-yl]-N-[10-[[2-[[2-[3-[(2-sulfanylacetyl)amino]prop-1-en-2-ylamino]acetyl]amino]acetyl]amino]decyl]benzamide.
| Compound Name | 4-[5-methyl-2-(4-sulfamoylphenyl)pyrazol-3-yl]-N-[10-[[2-[[2-[3-[(2-sulfanylacetyl)amino]prop-1-en-2-ylamino]acetyl]amino]acetyl]amino]decyl]benzamide |
|---|---|
| PubChem CID | 163638778 |
| Molecular Formula | C36H50N8O6S2 |
| Molecular Weight | 754.98 g/mol |
| Exact Mass | 754.33 |
| IUPAC Name | 4-[5-methyl-2-(4-sulfamoylphenyl)pyrazol-3-yl]-N-[10-[[2-[[2-[3-[(2-sulfanylacetyl)amino]prop-1-en-2-ylamino]acetyl]amino]acetyl]amino]decyl]benzamide |
| SMILES | C=C(CNC(=O)CS)NCC(=O)NCC(=O)NCCCCCCCCCCNC(=O)c1ccc(-c2cc(C)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C36H50N8O6S2/c1-26-21-32(44(43-26)30-15-17-31(18-16-30)52(37,49)50)28-11-13-29(14-12-28)36(48)39-20-10-8-6-4-3-5-7-9-19-38-33(45)24-42-34(46)23-40-27(2)22-41-35(47)25-51/h11-18,21,40,51H,2-10,19-20,22-25H2,1H3,(H,38,45)(H,39,48)(H,41,47)(H,42,46)(H2,37,49,50) |
| InChIKey | MBOUCYCQQBVYSZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 206.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.98 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|