C39H55N9O11S — CID 59309379
6-[[2-[[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methylamino]acetyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid (PubChem CID 59309379) has the molecular formula C39H55N9O11S and a molecular weight of 857.99 g/mol. Its IUPAC name is 6-[[2-[[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methylamino]acetyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid.
| Compound Name | 6-[[2-[[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methylamino]acetyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 59309379 |
| Molecular Formula | C39H55N9O11S |
| Molecular Weight | 857.99 g/mol |
| Exact Mass | 857.37 |
| IUPAC Name | 6-[[2-[[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methylamino]acetyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid |
| SMILES | Cc1ccc(-c2cc(CNCC(=O)NCCCCC(C(=O)O)N3CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC3)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C39H55N9O11S/c1-28-5-7-29(8-6-28)34-22-30(43-48(34)31-9-11-32(12-10-31)60(40,58)59)23-41-24-35(49)42-13-3-2-4-33(39(56)57)47-20-18-45(26-37(52)53)16-14-44(25-36(50)51)15-17-46(19-21-47)27-38(54)55/h5-12,22,33,41H,2-4,13-21,23-27H2,1H3,(H,42,49)(H,50,51)(H,52,53)(H,54,55)(H,56,57)(H2,40,58,59) |
| InChIKey | UVTRGJGVSQQZOI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 281.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.99 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|