C31H33N5OS — CID 87507494
2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-N-[[5-(4-methanethioylphenyl)-1-phenylpyrazol-3-yl]methyl]acetamide (PubChem CID 87507494) has the molecular formula C31H33N5OS and a molecular weight of 523.71 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-N-[[5-(4-methanethioylphenyl)-1-phenylpyrazol-3-yl]methyl]acetamide.
| Compound Name | 2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-N-[[5-(4-methanethioylphenyl)-1-phenylpyrazol-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 87507494 |
| Molecular Formula | C31H33N5OS |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-N-[[5-(4-methanethioylphenyl)-1-phenylpyrazol-3-yl]methyl]acetamide |
| SMILES | Cc1ccc(N2CCN(CC(=O)NCc3cc(-c4ccc(C=S)cc4)n(-c4ccccc4)n3)CC2)c(C)c1 |
| InChI | InChI=1S/C31H33N5OS/c1-23-8-13-29(24(2)18-23)35-16-14-34(15-17-35)21-31(37)32-20-27-19-30(26-11-9-25(22-38)10-12-26)36(33-27)28-6-4-3-5-7-28/h3-13,18-19,22H,14-17,20-21H2,1-2H3,(H,32,37) |
| InChIKey | FIXKWMBNRKICFC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|