C29H37FN4O4S — CID 163249475
N-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl]cyclopentanecarboxamide (PubChem CID 163249475) has the molecular formula C29H37FN4O4S and a molecular weight of 556.70 g/mol. Its IUPAC name is N-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl]cyclopentanecarboxamide.
| Compound Name | N-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 163249475 |
| Molecular Formula | C29H37FN4O4S |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | N-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl]cyclopentanecarboxamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(COCCCCCCCNC(=O)C3CCCC3)cc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H37FN4O4S/c30-24-12-10-22(11-13-24)28-20-25(33-34(28)26-14-16-27(17-15-26)39(31,36)37)21-38-19-7-3-1-2-6-18-32-29(35)23-8-4-5-9-23/h10-17,20,23H,1-9,18-19,21H2,(H,32,35)(H2,31,36,37) |
| InChIKey | WWBYEHWPBYJSGQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|