C29H39CuFN5O4S3-3 — CID 171654901
2-[2-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl-(2-sulfidoethyl)amino]ethylazanidyl]ethanethiolate;oxocopper (PubChem CID 171654901) has the molecular formula C29H39CuFN5O4S3-3 and a molecular weight of 700.41 g/mol. Its IUPAC name is 2-[2-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl-(2-sulfidoethyl)amino]ethylazanidyl]ethanethiolate;oxocopper.
| Compound Name | 2-[2-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl-(2-sulfidoethyl)amino]ethylazanidyl]ethanethiolate;oxocopper |
|---|---|
| PubChem CID | 171654901 |
| Molecular Formula | C29H39CuFN5O4S3-3 |
| Molecular Weight | 700.41 g/mol |
| Exact Mass | 699.15 |
| IUPAC Name | 2-[2-[7-[[5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methoxy]heptyl-(2-sulfidoethyl)amino]ethylazanidyl]ethanethiolate;oxocopper |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(COCCCCCCCN(CC[S-])CC[N-]CC[S-])cc2-c2ccc(F)cc2)cc1.O=[Cu] |
| InChI | InChI=1S/C29H41FN5O3S3.Cu.O/c30-25-8-6-24(7-9-25)29-22-26(33-35(29)27-10-12-28(13-11-27)41(31,36)37)23-38-19-5-3-1-2-4-16-34(18-21-40)17-14-32-15-20-39;;/h6-13,22,39-40H,1-5,14-21,23H2,(H2,31,36,37);;/q-1;;/p-2 |
| InChIKey | MJKZLBRPKUBTKU-UHFFFAOYSA-L |
| XLogP | 4.44 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|