C21H16N4O2S2 — CID 15908398
4-[3-(cyanomethyl)-5-(4-thiophen-3-ylphenyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 15908398) has the molecular formula C21H16N4O2S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 4-[3-(cyanomethyl)-5-(4-thiophen-3-ylphenyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-(cyanomethyl)-5-(4-thiophen-3-ylphenyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 15908398 |
| Molecular Formula | C21H16N4O2S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 4-[3-(cyanomethyl)-5-(4-thiophen-3-ylphenyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | N#CCc1cc(-c2ccc(-c3ccsc3)cc2)n(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C21H16N4O2S2/c22-11-9-18-13-21(16-3-1-15(2-4-16)17-10-12-28-14-17)25(24-18)19-5-7-20(8-6-19)29(23,26)27/h1-8,10,12-14H,9H2,(H2,23,26,27) |
| InChIKey | FIDLTSLNPPCASS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |