C25H27N4O6PS2 — CID 171345118
N-[diethoxyphosphoryl(phenyl)methyl]-1-(4-sulfamoylphenyl)-5-thiophen-3-ylpyrazole-3-carboxamide (PubChem CID 171345118) has the molecular formula C25H27N4O6PS2 and a molecular weight of 574.62 g/mol. Its IUPAC name is N-[diethoxyphosphoryl(phenyl)methyl]-1-(4-sulfamoylphenyl)-5-thiophen-3-ylpyrazole-3-carboxamide.
| Compound Name | N-[diethoxyphosphoryl(phenyl)methyl]-1-(4-sulfamoylphenyl)-5-thiophen-3-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 171345118 |
| Molecular Formula | C25H27N4O6PS2 |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | N-[diethoxyphosphoryl(phenyl)methyl]-1-(4-sulfamoylphenyl)-5-thiophen-3-ylpyrazole-3-carboxamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)c1cc(-c2ccsc2)n(-c2ccc(S(N)(=O)=O)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C25H27N4O6PS2/c1-3-34-36(31,35-4-2)25(18-8-6-5-7-9-18)27-24(30)22-16-23(19-14-15-37-17-19)29(28-22)20-10-12-21(13-11-20)38(26,32)33/h5-17,25H,3-4H2,1-2H3,(H,27,30)(H2,26,32,33) |
| InChIKey | BAPPNNLRYSTWQE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|