C27H28FN4O6PS — CID 171350670
N-[diethoxyphosphoryl(phenyl)methyl]-5-(2-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide (PubChem CID 171350670) has the molecular formula C27H28FN4O6PS and a molecular weight of 586.58 g/mol. Its IUPAC name is N-[diethoxyphosphoryl(phenyl)methyl]-5-(2-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide.
| Compound Name | N-[diethoxyphosphoryl(phenyl)methyl]-5-(2-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 171350670 |
| Molecular Formula | C27H28FN4O6PS |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | N-[diethoxyphosphoryl(phenyl)methyl]-5-(2-fluorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)c1cc(-c2ccccc2F)n(-c2ccc(S(N)(=O)=O)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C27H28FN4O6PS/c1-3-37-39(34,38-4-2)27(19-10-6-5-7-11-19)30-26(33)24-18-25(22-12-8-9-13-23(22)28)32(31-24)20-14-16-21(17-15-20)40(29,35)36/h5-18,27H,3-4H2,1-2H3,(H,30,33)(H2,29,35,36) |
| InChIKey | CWYSJCXIZMRPEZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|