C31H42N4O2S — CID 163249481
N-[9-[1-(4-aminosulfanylphenyl)-5-(4-methoxyphenyl)pyrazol-3-yl]nonyl]cyclopentanecarboxamide (PubChem CID 163249481) has the molecular formula C31H42N4O2S and a molecular weight of 534.77 g/mol. Its IUPAC name is N-[9-[1-(4-aminosulfanylphenyl)-5-(4-methoxyphenyl)pyrazol-3-yl]nonyl]cyclopentanecarboxamide.
| Compound Name | N-[9-[1-(4-aminosulfanylphenyl)-5-(4-methoxyphenyl)pyrazol-3-yl]nonyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 163249481 |
| Molecular Formula | C31H42N4O2S |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | N-[9-[1-(4-aminosulfanylphenyl)-5-(4-methoxyphenyl)pyrazol-3-yl]nonyl]cyclopentanecarboxamide |
| SMILES | COc1ccc(-c2cc(CCCCCCCCCNC(=O)C3CCCC3)nn2-c2ccc(SN)cc2)cc1 |
| InChI | InChI=1S/C31H42N4O2S/c1-37-28-18-14-24(15-19-28)30-23-26(34-35(30)27-16-20-29(38-32)21-17-27)13-7-5-3-2-4-6-10-22-33-31(36)25-11-8-9-12-25/h14-21,23,25H,2-13,22,32H2,1H3,(H,33,36) |
| InChIKey | CABDPTRYILIBCF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|