C20H24N4S — CID 177190553
S-[4-[5-(4-aminophenyl)-3-(3-methylbutyl)pyrazol-1-yl]phenyl]thiohydroxylamine (PubChem CID 177190553) has the molecular formula C20H24N4S and a molecular weight of 352.51 g/mol. Its IUPAC name is S-[4-[5-(4-aminophenyl)-3-(3-methylbutyl)pyrazol-1-yl]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[5-(4-aminophenyl)-3-(3-methylbutyl)pyrazol-1-yl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 177190553 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | S-[4-[5-(4-aminophenyl)-3-(3-methylbutyl)pyrazol-1-yl]phenyl]thiohydroxylamine |
| SMILES | CC(C)CCc1cc(-c2ccc(N)cc2)n(-c2ccc(SN)cc2)n1 |
| InChI | InChI=1S/C20H24N4S/c1-14(2)3-8-17-13-20(15-4-6-16(21)7-5-15)24(23-17)18-9-11-19(25-22)12-10-18/h4-7,9-14H,3,8,21-22H2,1-2H3 |
| InChIKey | VMNIDOUDIHIRRL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|