C30H32BrN5O5S — CID 130323433
2-[2-[4-[[5-(4-bromophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]anilino]-2-oxoethoxy]-N-butylacetamide (PubChem CID 130323433) has the molecular formula C30H32BrN5O5S and a molecular weight of 654.59 g/mol. Its IUPAC name is 2-[2-[4-[[5-(4-bromophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]anilino]-2-oxoethoxy]-N-butylacetamide.
| Compound Name | 2-[2-[4-[[5-(4-bromophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]anilino]-2-oxoethoxy]-N-butylacetamide |
|---|---|
| PubChem CID | 130323433 |
| Molecular Formula | C30H32BrN5O5S |
| Molecular Weight | 654.59 g/mol |
| Exact Mass | 653.13 |
| IUPAC Name | 2-[2-[4-[[5-(4-bromophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]anilino]-2-oxoethoxy]-N-butylacetamide |
| SMILES | CCCCNC(=O)COCC(=O)Nc1ccc(Cc2cc(-c3ccc(Br)cc3)n(-c3ccc(S(N)(=O)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C30H32BrN5O5S/c1-2-3-16-33-29(37)19-41-20-30(38)34-24-10-4-21(5-11-24)17-25-18-28(22-6-8-23(31)9-7-22)36(35-25)26-12-14-27(15-13-26)42(32,39)40/h4-15,18H,2-3,16-17,19-20H2,1H3,(H,33,37)(H,34,38)(H2,32,39,40) |
| InChIKey | UYYZSEZNWMQKEY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|