C21H28N3O5+ — CID 161252204
CID 161252204 (PubChem CID 161252204) has the molecular formula C21H28N3O5+ and a molecular weight of 402.47 g/mol.
| Compound Name | CID 161252204 |
|---|---|
| PubChem CID | 161252204 |
| Molecular Formula | C21H28N3O5+ |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | — |
| SMILES | CCCCCNC(=O)COCC(=O)Nc1ccc(CCC(=O)N2C[CH+]C2=O)cc1 |
| InChI | InChI=1S/C21H27N3O5/c1-2-3-4-12-22-18(25)14-29-15-19(26)23-17-8-5-16(6-9-17)7-10-20(27)24-13-11-21(24)28/h5-6,8-9,11H,2-4,7,10,12-15H2,1H3,(H-,22,23,25,26)/p+1 |
| InChIKey | NHACGYYFTGNLTR-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|