C19H24N2O6 — CID 71616719
2-[2-oxo-2-[4-[6-oxo-6-(2-oxoazetidin-1-yl)hexyl]anilino]ethoxy]acetic acid (PubChem CID 71616719) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-[2-oxo-2-[4-[6-oxo-6-(2-oxoazetidin-1-yl)hexyl]anilino]ethoxy]acetic acid.
| Compound Name | 2-[2-oxo-2-[4-[6-oxo-6-(2-oxoazetidin-1-yl)hexyl]anilino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 71616719 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-[2-oxo-2-[4-[6-oxo-6-(2-oxoazetidin-1-yl)hexyl]anilino]ethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)Nc1ccc(CCCCCC(=O)N2CCC2=O)cc1 |
| InChI | InChI=1S/C19H24N2O6/c22-16(12-27-13-19(25)26)20-15-8-6-14(7-9-15)4-2-1-3-5-17(23)21-11-10-18(21)24/h6-9H,1-5,10-13H2,(H,20,22)(H,25,26) |
| InChIKey | AOHMXDWIOARSPQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|