C30H32N4O12 — CID 159630361
1-[2-(4-aminophenyl)acetyl]azetidin-2-one;1,4-dioxane-2,6-dione;2-[2-oxo-2-[4-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]ethoxy]acetic acid (PubChem CID 159630361) has the molecular formula C30H32N4O12 and a molecular weight of 640.60 g/mol. Its IUPAC name is 1-[2-(4-aminophenyl)acetyl]azetidin-2-one;1,4-dioxane-2,6-dione;2-[2-oxo-2-[4-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]ethoxy]acetic acid.
| Compound Name | 1-[2-(4-aminophenyl)acetyl]azetidin-2-one;1,4-dioxane-2,6-dione;2-[2-oxo-2-[4-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 159630361 |
| Molecular Formula | C30H32N4O12 |
| Molecular Weight | 640.60 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | 1-[2-(4-aminophenyl)acetyl]azetidin-2-one;1,4-dioxane-2,6-dione;2-[2-oxo-2-[4-[2-oxo-2-(2-oxoazetidin-1-yl)ethyl]anilino]ethoxy]acetic acid |
| SMILES | Nc1ccc(CC(=O)N2CCC2=O)cc1.O=C(O)COCC(=O)Nc1ccc(CC(=O)N2CCC2=O)cc1.O=C1COCC(=O)O1 |
| InChI | InChI=1S/C15H16N2O6.C11H12N2O2.C4H4O4/c18-12(8-23-9-15(21)22)16-11-3-1-10(2-4-11)7-14(20)17-6-5-13(17)19;12-9-3-1-8(2-4-9)7-11(15)13-6-5-10(13)14;5-3-1-7-2-4(6)8-3/h1-4H,5-9H2,(H,16,18)(H,21,22);1-4H,5-7,12H2;1-2H2 |
| InChIKey | MPARTMTWNAEHIB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 229.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.60 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|