C18H22N2O6 — CID 71616718
2-[2-oxo-2-[4-[5-oxo-5-(2-oxoazetidin-1-yl)pentyl]anilino]ethoxy]acetic acid (PubChem CID 71616718) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-[2-oxo-2-[4-[5-oxo-5-(2-oxoazetidin-1-yl)pentyl]anilino]ethoxy]acetic acid.
| Compound Name | 2-[2-oxo-2-[4-[5-oxo-5-(2-oxoazetidin-1-yl)pentyl]anilino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 71616718 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[2-oxo-2-[4-[5-oxo-5-(2-oxoazetidin-1-yl)pentyl]anilino]ethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)Nc1ccc(CCCCC(=O)N2CCC2=O)cc1 |
| InChI | InChI=1S/C18H22N2O6/c21-15(11-26-12-18(24)25)19-14-7-5-13(6-8-14)3-1-2-4-16(22)20-10-9-17(20)23/h5-8H,1-4,9-12H2,(H,19,21)(H,24,25) |
| InChIKey | ZJABQYLUTOPKHJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|