C14H17N3O4 — CID 61312691
N-(4-aminophenyl)-4-(3,5-dioxomorpholin-4-yl)butanamide (PubChem CID 61312691) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-(3,5-dioxomorpholin-4-yl)butanamide.
| Compound Name | N-(4-aminophenyl)-4-(3,5-dioxomorpholin-4-yl)butanamide |
|---|---|
| PubChem CID | 61312691 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-(4-aminophenyl)-4-(3,5-dioxomorpholin-4-yl)butanamide |
| SMILES | Nc1ccc(NC(=O)CCCN2C(=O)COCC2=O)cc1 |
| InChI | InChI=1S/C14H17N3O4/c15-10-3-5-11(6-4-10)16-12(18)2-1-7-17-13(19)8-21-9-14(17)20/h3-6H,1-2,7-9,15H2,(H,16,18) |
| InChIKey | RRXFJTBPFVADST-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|