C14H17N3O3 — CID 43447501
N-(4-aminophenyl)-3-(2,6-dioxopiperidin-1-yl)propanamide (PubChem CID 43447501) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-(4-aminophenyl)-3-(2,6-dioxopiperidin-1-yl)propanamide.
| Compound Name | N-(4-aminophenyl)-3-(2,6-dioxopiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 43447501 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(4-aminophenyl)-3-(2,6-dioxopiperidin-1-yl)propanamide |
| SMILES | Nc1ccc(NC(=O)CCN2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C14H17N3O3/c15-10-4-6-11(7-5-10)16-12(18)8-9-17-13(19)2-1-3-14(17)20/h4-7H,1-3,8-9,15H2,(H,16,18) |
| InChIKey | DJEAPCJKOPNLIR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|