C21H30N3O5P — CID 163779995
N-(3-cyclopentyl-3-oxopropyl)-3-[4-[[2-[2-oxo-2-(phosphanylamino)ethoxy]acetyl]amino]phenyl]propanamide (PubChem CID 163779995) has the molecular formula C21H30N3O5P and a molecular weight of 435.46 g/mol. Its IUPAC name is N-(3-cyclopentyl-3-oxopropyl)-3-[4-[[2-[2-oxo-2-(phosphanylamino)ethoxy]acetyl]amino]phenyl]propanamide.
| Compound Name | N-(3-cyclopentyl-3-oxopropyl)-3-[4-[[2-[2-oxo-2-(phosphanylamino)ethoxy]acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 163779995 |
| Molecular Formula | C21H30N3O5P |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-(3-cyclopentyl-3-oxopropyl)-3-[4-[[2-[2-oxo-2-(phosphanylamino)ethoxy]acetyl]amino]phenyl]propanamide |
| SMILES | O=C(COCC(=O)Nc1ccc(CCC(=O)NCCC(=O)C2CCCC2)cc1)NP |
| InChI | InChI=1S/C21H30N3O5P/c25-18(16-3-1-2-4-16)11-12-22-19(26)10-7-15-5-8-17(9-6-15)23-20(27)13-29-14-21(28)24-30/h5-6,8-9,16H,1-4,7,10-14,30H2,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | MNUWWDOXXCHZRW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|