C22H30N2O6S2 — CID 160905008
3-[4-[[2-[3-(methyldisulfanyl)-2,4-dioxopentoxy]acetyl]amino]phenyl]-N-(3-oxopentyl)propanamide (PubChem CID 160905008) has the molecular formula C22H30N2O6S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is 3-[4-[[2-[3-(methyldisulfanyl)-2,4-dioxopentoxy]acetyl]amino]phenyl]-N-(3-oxopentyl)propanamide.
| Compound Name | 3-[4-[[2-[3-(methyldisulfanyl)-2,4-dioxopentoxy]acetyl]amino]phenyl]-N-(3-oxopentyl)propanamide |
|---|---|
| PubChem CID | 160905008 |
| Molecular Formula | C22H30N2O6S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 3-[4-[[2-[3-(methyldisulfanyl)-2,4-dioxopentoxy]acetyl]amino]phenyl]-N-(3-oxopentyl)propanamide |
| SMILES | CCC(=O)CCNC(=O)CCc1ccc(NC(=O)COCC(=O)C(SSC)C(C)=O)cc1 |
| InChI | InChI=1S/C22H30N2O6S2/c1-4-18(26)11-12-23-20(28)10-7-16-5-8-17(9-6-16)24-21(29)14-30-13-19(27)22(15(2)25)32-31-3/h5-6,8-9,22H,4,7,10-14H2,1-3H3,(H,23,28)(H,24,29) |
| InChIKey | JMXOIPCIJXXKEL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|