C35H50N4O5 — CID 123942323
N-[3-(4-cyclopentylbutylamino)-3-oxopropyl]-3-[4-[[2-[2-[3-(3-methylphenyl)propylamino]-2-oxoethoxy]acetyl]amino]phenyl]propanamide (PubChem CID 123942323) has the molecular formula C35H50N4O5 and a molecular weight of 606.81 g/mol. Its IUPAC name is N-[3-(4-cyclopentylbutylamino)-3-oxopropyl]-3-[4-[[2-[2-[3-(3-methylphenyl)propylamino]-2-oxoethoxy]acetyl]amino]phenyl]propanamide.
| Compound Name | N-[3-(4-cyclopentylbutylamino)-3-oxopropyl]-3-[4-[[2-[2-[3-(3-methylphenyl)propylamino]-2-oxoethoxy]acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 123942323 |
| Molecular Formula | C35H50N4O5 |
| Molecular Weight | 606.81 g/mol |
| Exact Mass | 606.38 |
| IUPAC Name | N-[3-(4-cyclopentylbutylamino)-3-oxopropyl]-3-[4-[[2-[2-[3-(3-methylphenyl)propylamino]-2-oxoethoxy]acetyl]amino]phenyl]propanamide |
| SMILES | Cc1cccc(CCCNC(=O)COCC(=O)Nc2ccc(CCC(=O)NCCC(=O)NCCCCC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C35H50N4O5/c1-27-8-6-12-30(24-27)13-7-22-37-34(42)25-44-26-35(43)39-31-17-14-29(15-18-31)16-19-32(40)38-23-20-33(41)36-21-5-4-11-28-9-2-3-10-28/h6,8,12,14-15,17-18,24,28H,2-5,7,9-11,13,16,19-23,25-26H2,1H3,(H,36,41)(H,37,42)(H,38,40)(H,39,43) |
| InChIKey | AXNULMZUJGKROI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.81 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|