C13H18BrNO — CID 62365535
N-(3-bromopropyl)-3-(3-methylphenyl)propanamide (PubChem CID 62365535) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is N-(3-bromopropyl)-3-(3-methylphenyl)propanamide.
| Compound Name | N-(3-bromopropyl)-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 62365535 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-(3-bromopropyl)-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(CCC(=O)NCCCBr)c1 |
| InChI | InChI=1S/C13H18BrNO/c1-11-4-2-5-12(10-11)6-7-13(16)15-9-3-8-14/h2,4-5,10H,3,6-9H2,1H3,(H,15,16) |
| InChIKey | YPBUKOIWIZLHAC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|