C15H22BrNO — CID 113276046
N-(5-bromopentan-2-yl)-3-(3-methylphenyl)propanamide (PubChem CID 113276046) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is N-(5-bromopentan-2-yl)-3-(3-methylphenyl)propanamide.
| Compound Name | N-(5-bromopentan-2-yl)-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 113276046 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(5-bromopentan-2-yl)-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(CCC(=O)NC(C)CCCBr)c1 |
| InChI | InChI=1S/C15H22BrNO/c1-12-5-3-7-14(11-12)8-9-15(18)17-13(2)6-4-10-16/h3,5,7,11,13H,4,6,8-10H2,1-2H3,(H,17,18) |
| InChIKey | AJVHAJDAUMAATQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|