C26H44N4O5 — CID 161341478
N-butyl-2-methoxyacetamide;N-[2-oxo-2-(pentylamino)ethyl]-3-[4-(propanoylamino)phenyl]propanamide (PubChem CID 161341478) has the molecular formula C26H44N4O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is N-butyl-2-methoxyacetamide;N-[2-oxo-2-(pentylamino)ethyl]-3-[4-(propanoylamino)phenyl]propanamide.
| Compound Name | N-butyl-2-methoxyacetamide;N-[2-oxo-2-(pentylamino)ethyl]-3-[4-(propanoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 161341478 |
| Molecular Formula | C26H44N4O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | N-butyl-2-methoxyacetamide;N-[2-oxo-2-(pentylamino)ethyl]-3-[4-(propanoylamino)phenyl]propanamide |
| SMILES | CCCCCNC(=O)CNC(=O)CCc1ccc(NC(=O)CC)cc1.CCCCNC(=O)COC |
| InChI | InChI=1S/C19H29N3O3.C7H15NO2/c1-3-5-6-13-20-19(25)14-21-18(24)12-9-15-7-10-16(11-8-15)22-17(23)4-2;1-3-4-5-8-7(9)6-10-2/h7-8,10-11H,3-6,9,12-14H2,1-2H3,(H,20,25)(H,21,24)(H,22,23);3-6H2,1-2H3,(H,8,9) |
| InChIKey | VMSKRAUZCYHXGF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|