C37H54N4O8 — CID 126699016
N-(3-cyclohexyl-3-oxopropyl)-3-[4-[3-[2-[2-[3-(3-cyclopentyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]propanamide (PubChem CID 126699016) has the molecular formula C37H54N4O8 and a molecular weight of 682.86 g/mol. Its IUPAC name is N-(3-cyclohexyl-3-oxopropyl)-3-[4-[3-[2-[2-[3-(3-cyclopentyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]propanamide.
| Compound Name | N-(3-cyclohexyl-3-oxopropyl)-3-[4-[3-[2-[2-[3-(3-cyclopentyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 126699016 |
| Molecular Formula | C37H54N4O8 |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.39 |
| IUPAC Name | N-(3-cyclohexyl-3-oxopropyl)-3-[4-[3-[2-[2-[3-(3-cyclopentyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]propanamide |
| SMILES | O=C(CCc1ccc(NC(=O)CCOCCOCCNC(=O)CCN2C(=O)CC(C3CCCC3)C2=O)cc1)NCCC(=O)C1CCCCC1 |
| InChI | InChI=1S/C37H54N4O8/c42-32(29-8-2-1-3-9-29)16-19-38-33(43)15-12-27-10-13-30(14-11-27)40-35(45)18-22-48-24-25-49-23-20-39-34(44)17-21-41-36(46)26-31(37(41)47)28-6-4-5-7-28/h10-11,13-14,28-29,31H,1-9,12,15-26H2,(H,38,43)(H,39,44)(H,40,45) |
| InChIKey | MUQHILGJPVEMMV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|