C28H40N4O8 — CID 70959234
3-[4-[3-[2-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide (PubChem CID 70959234) has the molecular formula C28H40N4O8 and a molecular weight of 560.65 g/mol. Its IUPAC name is 3-[4-[3-[2-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide.
| Compound Name | 3-[4-[3-[2-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide |
|---|---|
| PubChem CID | 70959234 |
| Molecular Formula | C28H40N4O8 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 3-[4-[3-[2-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide |
| SMILES | CC(=O)CCNC(=O)CCc1ccc(NC(=O)CCOCCOCCNC(=O)CCN2C(=O)CC(C)C2=O)cc1 |
| InChI | InChI=1S/C28H40N4O8/c1-20-19-27(37)32(28(20)38)14-10-25(35)30-13-16-40-18-17-39-15-11-26(36)31-23-6-3-22(4-7-23)5-8-24(34)29-12-9-21(2)33/h3-4,6-7,20H,5,8-19H2,1-2H3,(H,29,34)(H,30,35)(H,31,36) |
| InChIKey | ISZDSZYPVJJCLR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|