C29H42N4O8 — CID 70959242
3-[4-[3-[2-[2-[3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide (PubChem CID 70959242) has the molecular formula C29H42N4O8 and a molecular weight of 574.68 g/mol. Its IUPAC name is 3-[4-[3-[2-[2-[3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide.
| Compound Name | 3-[4-[3-[2-[2-[3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide |
|---|---|
| PubChem CID | 70959242 |
| Molecular Formula | C29H42N4O8 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | 3-[4-[3-[2-[2-[3-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide |
| SMILES | CC(=O)CCNC(=O)CCc1ccc(NC(=O)CCOCCOCCNC(=O)CCN2C(=O)CC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C29H42N4O8/c1-21(34)10-13-30-24(35)9-6-22-4-7-23(8-5-22)32-26(37)12-16-40-18-19-41-17-14-31-25(36)11-15-33-27(38)20-29(2,3)28(33)39/h4-5,7-8H,6,9-20H2,1-3H3,(H,30,35)(H,31,36)(H,32,37) |
| InChIKey | NBJJIFFQIXRIOQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|