C27H40N4O7S — CID 161454651
methanethiol;3-[4-[3-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide (PubChem CID 161454651) has the molecular formula C27H40N4O7S and a molecular weight of 564.71 g/mol. Its IUPAC name is methanethiol;3-[4-[3-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide.
| Compound Name | methanethiol;3-[4-[3-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide |
|---|---|
| PubChem CID | 161454651 |
| Molecular Formula | C27H40N4O7S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | methanethiol;3-[4-[3-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]propanoylamino]phenyl]-N-(3-oxobutyl)propanamide |
| SMILES | CC(=O)CCNC(=O)CCc1ccc(NC(=O)CCOCCNC(=O)CCN2C(=O)CC(C)C2=O)cc1.CS |
| InChI | InChI=1S/C26H36N4O7.CH4S/c1-18-17-25(35)30(26(18)36)14-10-23(33)28-13-16-37-15-11-24(34)29-21-6-3-20(4-7-21)5-8-22(32)27-12-9-19(2)31;1-2/h3-4,6-7,18H,5,8-17H2,1-2H3,(H,27,32)(H,28,33)(H,29,34);2H,1H3 |
| InChIKey | WAZLTOKAPRBLDU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|