C23H38N4O8 — CID 144981797
(2S)-3-methyl-2-[3-[2-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]-N-(2-oxopropyl)butanamide (PubChem CID 144981797) has the molecular formula C23H38N4O8 and a molecular weight of 498.58 g/mol. Its IUPAC name is (2S)-3-methyl-2-[3-[2-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]-N-(2-oxopropyl)butanamide.
| Compound Name | (2S)-3-methyl-2-[3-[2-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]-N-(2-oxopropyl)butanamide |
|---|---|
| PubChem CID | 144981797 |
| Molecular Formula | C23H38N4O8 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | (2S)-3-methyl-2-[3-[2-[2-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]-N-(2-oxopropyl)butanamide |
| SMILES | CC(=O)CNC(=O)[C@@H](NC(=O)CCOCCOCCNC(=O)CCN1C(=O)CC(C)C1=O)C(C)C |
| InChI | InChI=1S/C23H38N4O8/c1-15(2)21(22(32)25-14-17(4)28)26-19(30)6-9-34-11-12-35-10-7-24-18(29)5-8-27-20(31)13-16(3)23(27)33/h15-16,21H,5-14H2,1-4H3,(H,24,29)(H,25,32)(H,26,30)/t16?,21-/m0/s1 |
| InChIKey | IJNIHTCFKZLKJQ-MRNPHLECSA-N |
| XLogP | -0.84 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|