C30H54N2O10S — CID 166072974
3-[2,5-dioxo-3-(thiocan-5-yl)pyrrolidin-1-yl]-N-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 166072974) has the molecular formula C30H54N2O10S and a molecular weight of 634.83 g/mol. Its IUPAC name is 3-[2,5-dioxo-3-(thiocan-5-yl)pyrrolidin-1-yl]-N-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 3-[2,5-dioxo-3-(thiocan-5-yl)pyrrolidin-1-yl]-N-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 166072974 |
| Molecular Formula | C30H54N2O10S |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | 3-[2,5-dioxo-3-(thiocan-5-yl)pyrrolidin-1-yl]-N-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN1C(=O)CC(C2CCCSCCC2)C1=O |
| InChI | InChI=1S/C30H54N2O10S/c1-2-36-11-12-38-15-16-40-19-20-42-22-21-41-18-17-39-14-13-37-10-8-31-28(33)7-9-32-29(34)25-27(30(32)35)26-5-3-23-43-24-4-6-26/h26-27H,2-25H2,1H3,(H,31,33) |
| InChIKey | VQGFXJJIUCWWOR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|