C18H27NO2S — CID 100591529
N-(2-cyclohexylsulfanylethyl)-3-(4-methoxyphenyl)propanamide (PubChem CID 100591529) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 100591529 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCCSC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H27NO2S/c1-21-16-10-7-15(8-11-16)9-12-18(20)19-13-14-22-17-5-3-2-4-6-17/h7-8,10-11,17H,2-6,9,12-14H2,1H3,(H,19,20) |
| InChIKey | GEINEYHBFVGVPC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|