C28H28F3N5O3S — CID 67992576
1-[3-[5-(4-ethylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 67992576) has the molecular formula C28H28F3N5O3S and a molecular weight of 571.63 g/mol. Its IUPAC name is 1-[3-[5-(4-ethylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[5-(4-ethylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 67992576 |
| Molecular Formula | C28H28F3N5O3S |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 1-[3-[5-(4-ethylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCc1ccc(-c2cc(CCCNC(=O)Nc3cccc(C(F)(F)F)c3)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C28H28F3N5O3S/c1-2-19-8-10-20(11-9-19)26-18-23(35-36(26)24-12-14-25(15-13-24)40(32,38)39)7-4-16-33-27(37)34-22-6-3-5-21(17-22)28(29,30)31/h3,5-6,8-15,17-18H,2,4,7,16H2,1H3,(H2,32,38,39)(H2,33,34,37) |
| InChIKey | ZZVOFILKSMNJGU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|