C22H22N4O11S — CID 144534553
(4-carbamothioylphenyl) 4-(4-nitrooxybutanoylamino)-2-(4-nitrooxybutanoyloxy)benzoate (PubChem CID 144534553) has the molecular formula C22H22N4O11S and a molecular weight of 550.50 g/mol. Its IUPAC name is (4-carbamothioylphenyl) 4-(4-nitrooxybutanoylamino)-2-(4-nitrooxybutanoyloxy)benzoate.
| Compound Name | (4-carbamothioylphenyl) 4-(4-nitrooxybutanoylamino)-2-(4-nitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 144534553 |
| Molecular Formula | C22H22N4O11S |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | (4-carbamothioylphenyl) 4-(4-nitrooxybutanoylamino)-2-(4-nitrooxybutanoyloxy)benzoate |
| SMILES | NC(=S)c1ccc(OC(=O)c2ccc(NC(=O)CCCO[N+](=O)[O-])cc2OC(=O)CCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H22N4O11S/c23-21(38)14-5-8-16(9-6-14)36-22(29)17-10-7-15(24-19(27)3-1-11-34-25(30)31)13-18(17)37-20(28)4-2-12-35-26(32)33/h5-10,13H,1-4,11-12H2,(H2,23,38)(H,24,27) |
| InChIKey | BRDOKPLSLSBLHF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 212.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|