C21H22N2O5S — CID 90323403
(4-carbamothioylphenyl) 2-acetyloxy-4-(pentanoylamino)benzoate (PubChem CID 90323403) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is (4-carbamothioylphenyl) 2-acetyloxy-4-(pentanoylamino)benzoate.
| Compound Name | (4-carbamothioylphenyl) 2-acetyloxy-4-(pentanoylamino)benzoate |
|---|---|
| PubChem CID | 90323403 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (4-carbamothioylphenyl) 2-acetyloxy-4-(pentanoylamino)benzoate |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)Oc2ccc(C(N)=S)cc2)c(OC(C)=O)c1 |
| InChI | InChI=1S/C21H22N2O5S/c1-3-4-5-19(25)23-15-8-11-17(18(12-15)27-13(2)24)21(26)28-16-9-6-14(7-10-16)20(22)29/h6-12H,3-5H2,1-2H3,(H2,22,29)(H,23,25) |
| InChIKey | KJNMAIHTVONXMZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|