C19H20N2O4S — CID 90323436
(4-carbamothioylphenyl) 2-hydroxy-4-(pentanoylamino)benzoate (PubChem CID 90323436) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (4-carbamothioylphenyl) 2-hydroxy-4-(pentanoylamino)benzoate.
| Compound Name | (4-carbamothioylphenyl) 2-hydroxy-4-(pentanoylamino)benzoate |
|---|---|
| PubChem CID | 90323436 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (4-carbamothioylphenyl) 2-hydroxy-4-(pentanoylamino)benzoate |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)Oc2ccc(C(N)=S)cc2)c(O)c1 |
| InChI | InChI=1S/C19H20N2O4S/c1-2-3-4-17(23)21-13-7-10-15(16(22)11-13)19(24)25-14-8-5-12(6-9-14)18(20)26/h5-11,22H,2-4H2,1H3,(H2,20,26)(H,21,23) |
| InChIKey | LOCZLKCHCRQMNJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|