C23H25N3O8S — CID 90323546
(4-carbamothioylphenyl) 2-(4-nitrooxybutanoyloxy)-4-(pentanoylamino)benzoate (PubChem CID 90323546) has the molecular formula C23H25N3O8S and a molecular weight of 503.53 g/mol. Its IUPAC name is (4-carbamothioylphenyl) 2-(4-nitrooxybutanoyloxy)-4-(pentanoylamino)benzoate.
| Compound Name | (4-carbamothioylphenyl) 2-(4-nitrooxybutanoyloxy)-4-(pentanoylamino)benzoate |
|---|---|
| PubChem CID | 90323546 |
| Molecular Formula | C23H25N3O8S |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | (4-carbamothioylphenyl) 2-(4-nitrooxybutanoyloxy)-4-(pentanoylamino)benzoate |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)Oc2ccc(C(N)=S)cc2)c(OC(=O)CCCO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25N3O8S/c1-2-3-5-20(27)25-16-9-12-18(19(14-16)34-21(28)6-4-13-32-26(30)31)23(29)33-17-10-7-15(8-11-17)22(24)35/h7-12,14H,2-6,13H2,1H3,(H2,24,35)(H,25,27) |
| InChIKey | XFRFTXWIIVCPPK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 160.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|