C23H22N4O15S — CID 90323330
1-O-(4-carbamothioylphenyl) 4-O-[2-[3-nitrooxy-2,2-bis(nitrooxymethyl)propoxy]carbonylphenyl] butanedioate (PubChem CID 90323330) has the molecular formula C23H22N4O15S and a molecular weight of 626.51 g/mol. Its IUPAC name is 1-O-(4-carbamothioylphenyl) 4-O-[2-[3-nitrooxy-2,2-bis(nitrooxymethyl)propoxy]carbonylphenyl] butanedioate.
| Compound Name | 1-O-(4-carbamothioylphenyl) 4-O-[2-[3-nitrooxy-2,2-bis(nitrooxymethyl)propoxy]carbonylphenyl] butanedioate |
|---|---|
| PubChem CID | 90323330 |
| Molecular Formula | C23H22N4O15S |
| Molecular Weight | 626.51 g/mol |
| Exact Mass | 626.08 |
| IUPAC Name | 1-O-(4-carbamothioylphenyl) 4-O-[2-[3-nitrooxy-2,2-bis(nitrooxymethyl)propoxy]carbonylphenyl] butanedioate |
| SMILES | NC(=S)c1ccc(OC(=O)CCC(=O)Oc2ccccc2C(=O)OCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22N4O15S/c24-21(43)15-5-7-16(8-6-15)41-19(28)9-10-20(29)42-18-4-2-1-3-17(18)22(30)37-11-23(12-38-25(31)32,13-39-26(33)34)14-40-27(35)36/h1-8H,9-14H2,(H2,24,43) |
| InChIKey | FPHNOYLVBWDYCV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 262.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|