C18H15NO5S — CID 153234236
(4-carbamothioylphenyl) 2-(4-oxobutanoyloxy)benzoate (PubChem CID 153234236) has the molecular formula C18H15NO5S and a molecular weight of 357.39 g/mol. Its IUPAC name is (4-carbamothioylphenyl) 2-(4-oxobutanoyloxy)benzoate.
| Compound Name | (4-carbamothioylphenyl) 2-(4-oxobutanoyloxy)benzoate |
|---|---|
| PubChem CID | 153234236 |
| Molecular Formula | C18H15NO5S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (4-carbamothioylphenyl) 2-(4-oxobutanoyloxy)benzoate |
| SMILES | NC(=S)c1ccc(OC(=O)c2ccccc2OC(=O)CCC=O)cc1 |
| InChI | InChI=1S/C18H15NO5S/c19-17(25)12-7-9-13(10-8-12)23-18(22)14-4-1-2-5-15(14)24-16(21)6-3-11-20/h1-2,4-5,7-11H,3,6H2,(H2,19,25) |
| InChIKey | SHAUCOOCOZKZGV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|