C24H26N2O8S — CID 158156431
(4-carbamothioylphenyl) 2-(4-nitrooxybutanoyloxy)-5-(2-oxohexyl)benzoate (PubChem CID 158156431) has the molecular formula C24H26N2O8S and a molecular weight of 502.55 g/mol. Its IUPAC name is (4-carbamothioylphenyl) 2-(4-nitrooxybutanoyloxy)-5-(2-oxohexyl)benzoate.
| Compound Name | (4-carbamothioylphenyl) 2-(4-nitrooxybutanoyloxy)-5-(2-oxohexyl)benzoate |
|---|---|
| PubChem CID | 158156431 |
| Molecular Formula | C24H26N2O8S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (4-carbamothioylphenyl) 2-(4-nitrooxybutanoyloxy)-5-(2-oxohexyl)benzoate |
| SMILES | CCCCC(=O)Cc1ccc(OC(=O)CCCO[N+](=O)[O-])c(C(=O)Oc2ccc(C(N)=S)cc2)c1 |
| InChI | InChI=1S/C24H26N2O8S/c1-2-3-5-18(27)14-16-7-12-21(34-22(28)6-4-13-32-26(30)31)20(15-16)24(29)33-19-10-8-17(9-11-19)23(25)35/h7-12,15H,2-6,13-14H2,1H3,(H2,25,35) |
| InChIKey | AEFUHDMEWBUGOK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|