C23H26N3O9PS2 — CID 90323404
[4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 5-acetamido-2-(4-nitrooxybutanoyloxy)benzoate (PubChem CID 90323404) has the molecular formula C23H26N3O9PS2 and a molecular weight of 583.58 g/mol. Its IUPAC name is [4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 5-acetamido-2-(4-nitrooxybutanoyloxy)benzoate.
| Compound Name | [4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 5-acetamido-2-(4-nitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 90323404 |
| Molecular Formula | C23H26N3O9PS2 |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | [4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 5-acetamido-2-(4-nitrooxybutanoyloxy)benzoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)CCCO[N+](=O)[O-])c(C(=O)Oc2ccc(P(=S)(S)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C23H26N3O9PS2/c1-16(27)24-17-4-9-21(35-22(28)3-2-12-33-26(30)31)20(15-17)23(29)34-18-5-7-19(8-6-18)36(37,38)25-10-13-32-14-11-25/h4-9,15H,2-3,10-14H2,1H3,(H,24,27)(H,37,38) |
| InChIKey | JIKVNQQORJSCON-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|