C22H26N3O9PS — CID 144534370
[4-[methoxysulfanyl(morpholin-4-yl)phosphanyl]phenyl] 2-hydroxy-4-(4-nitrooxybutanoylamino)benzoate (PubChem CID 144534370) has the molecular formula C22H26N3O9PS and a molecular weight of 539.50 g/mol. Its IUPAC name is [4-[methoxysulfanyl(morpholin-4-yl)phosphanyl]phenyl] 2-hydroxy-4-(4-nitrooxybutanoylamino)benzoate.
| Compound Name | [4-[methoxysulfanyl(morpholin-4-yl)phosphanyl]phenyl] 2-hydroxy-4-(4-nitrooxybutanoylamino)benzoate |
|---|---|
| PubChem CID | 144534370 |
| Molecular Formula | C22H26N3O9PS |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | [4-[methoxysulfanyl(morpholin-4-yl)phosphanyl]phenyl] 2-hydroxy-4-(4-nitrooxybutanoylamino)benzoate |
| SMILES | COSP(c1ccc(OC(=O)c2ccc(NC(=O)CCCO[N+](=O)[O-])cc2O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H26N3O9PS/c1-31-36-35(24-10-13-32-14-11-24)18-7-5-17(6-8-18)34-22(28)19-9-4-16(15-20(19)26)23-21(27)3-2-12-33-25(29)30/h4-9,15,26H,2-3,10-14H2,1H3,(H,23,27) |
| InChIKey | ZJTPSGZKQVYWDL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|