C23H26N3O11PS2 — CID 158992935
[4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 2-(3,4-dinitrooxybutanoyloxy)-5-ethylbenzoate (PubChem CID 158992935) has the molecular formula C23H26N3O11PS2 and a molecular weight of 615.58 g/mol. Its IUPAC name is [4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 2-(3,4-dinitrooxybutanoyloxy)-5-ethylbenzoate.
| Compound Name | [4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 2-(3,4-dinitrooxybutanoyloxy)-5-ethylbenzoate |
|---|---|
| PubChem CID | 158992935 |
| Molecular Formula | C23H26N3O11PS2 |
| Molecular Weight | 615.58 g/mol |
| Exact Mass | 615.07 |
| IUPAC Name | [4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 2-(3,4-dinitrooxybutanoyloxy)-5-ethylbenzoate |
| SMILES | CCc1ccc(OC(=O)CC(CO[N+](=O)[O-])O[N+](=O)[O-])c(C(=O)Oc2ccc(P(=S)(S)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C23H26N3O11PS2/c1-2-16-3-8-21(36-22(27)14-18(37-26(31)32)15-34-25(29)30)20(13-16)23(28)35-17-4-6-19(7-5-17)38(39,40)24-9-11-33-12-10-24/h3-8,13,18H,2,9-12,14-15H2,1H3,(H,39,40) |
| InChIKey | VDZKGRGTQSGJOL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 169.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|