C27H25NO9P2S4 — CID 158325767
[4-[4-(4-hydroxyphenyl)-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetan-2-yl]phenyl] 2-acetyloxy-5-(4-nitrooxy-2-oxohexyl)benzoate (PubChem CID 158325767) has the molecular formula C27H25NO9P2S4 and a molecular weight of 697.71 g/mol. Its IUPAC name is [4-[4-(4-hydroxyphenyl)-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetan-2-yl]phenyl] 2-acetyloxy-5-(4-nitrooxy-2-oxohexyl)benzoate.
| Compound Name | [4-[4-(4-hydroxyphenyl)-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetan-2-yl]phenyl] 2-acetyloxy-5-(4-nitrooxy-2-oxohexyl)benzoate |
|---|---|
| PubChem CID | 158325767 |
| Molecular Formula | C27H25NO9P2S4 |
| Molecular Weight | 697.71 g/mol |
| Exact Mass | 696.99 |
| IUPAC Name | [4-[4-(4-hydroxyphenyl)-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetan-2-yl]phenyl] 2-acetyloxy-5-(4-nitrooxy-2-oxohexyl)benzoate |
| SMILES | CCC(CC(=O)Cc1ccc(OC(C)=O)c(C(=O)Oc2ccc(P3(=S)SP(=S)(c4ccc(O)cc4)S3)cc2)c1)O[N+](=O)[O-] |
| InChI | InChI=1S/C27H25NO9P2S4/c1-3-21(37-28(33)34)16-20(31)14-18-4-13-26(35-17(2)29)25(15-18)27(32)36-22-7-11-24(12-8-22)39(41)42-38(40,43-39)23-9-5-19(30)6-10-23/h4-13,15,21,30H,3,14,16H2,1-2H3 |
| InChIKey | BUWIDTPMXRBJTK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|