C20H15NO6P2S4 — CID 11976788
5-amino-2-[4-[4-(4-hydroxyphenyl)-2,4-bis(sulfanylidene)-1,3,2lambda5,4lambda5-dithiadiphosphetan-2-yl]phenoxy]carbonyloxybenzoic acid (PubChem CID 11976788) has the molecular formula C20H15NO6P2S4 and a molecular weight of 555.56 g/mol. Its IUPAC name is 5-amino-2-[4-[4-(4-hydroxyphenyl)-2,4-bis(sulfanylidene)-1,3,2lambda5,4lambda5-dithiadiphosphetan-2-yl]phenoxy]carbonyloxybenzoic acid.
| Compound Name | 5-amino-2-[4-[4-(4-hydroxyphenyl)-2,4-bis(sulfanylidene)-1,3,2lambda5,4lambda5-dithiadiphosphetan-2-yl]phenoxy]carbonyloxybenzoic acid |
|---|---|
| PubChem CID | 11976788 |
| Molecular Formula | C20H15NO6P2S4 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 554.93 |
| IUPAC Name | 5-amino-2-[4-[4-(4-hydroxyphenyl)-2,4-bis(sulfanylidene)-1,3,2lambda5,4lambda5-dithiadiphosphetan-2-yl]phenoxy]carbonyloxybenzoic acid |
| SMILES | Nc1ccc(OC(=O)Oc2ccc(P3(=S)SP(=S)(c4ccc(O)cc4)S3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H15NO6P2S4/c21-12-1-10-18(17(11-12)19(23)24)27-20(25)26-14-4-8-16(9-5-14)29(31)32-28(30,33-29)15-6-2-13(22)3-7-15/h1-11,22H,21H2,(H,23,24) |
| InChIKey | WUMFLAUYTRNQBK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|