About [4-(chloromethyl)phenyl] 2-acetyloxybenzoate
[4-(chloromethyl)phenyl] 2-acetyloxybenzoate (PubChem CID 10859700) has the molecular formula C16H13ClO4
and a molecular weight of 304.73 g/mol. Its IUPAC name is [4-(chloromethyl)phenyl] 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | [4-(chloromethyl)phenyl] 2-acetyloxybenzoate |
| PubChem CID | 10859700 |
| Molecular Formula | C16H13ClO4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | [4-(chloromethyl)phenyl] 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)Oc1ccc(CCl)cc1 |
| InChI | InChI=1S/C16H13ClO4/c1-11(18)20-15-5-3-2-4-14(15)16(19)21-13-8-6-12(10-17)7-9-13/h2-9H,10H2,1H3 |
| InChIKey | HPVHLAMKCLTACJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(chloromethyl)phenyl] 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(chloromethyl)phenyl] 2-acetyloxybenzoate?
The IUPAC name of [4-(chloromethyl)phenyl] 2-acetyloxybenzoate (CID 10859700) is [4-(chloromethyl)phenyl] 2-acetyloxybenzoate.
What is the SMILES notation for [4-(chloromethyl)phenyl] 2-acetyloxybenzoate?
The canonical SMILES for [4-(chloromethyl)phenyl] 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)Oc1ccc(CCl)cc1.
What is the InChIKey of [4-(chloromethyl)phenyl] 2-acetyloxybenzoate?
The InChIKey is HPVHLAMKCLTACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClO4/c1-11(18)20-15-5-3-2-4-14(15)16(19)21-13-8-6-12(10-17)7-9-13/h2-9H,10H2,1H3.
What are the key properties of [4-(chloromethyl)phenyl] 2-acetyloxybenzoate?
[4-(chloromethyl)phenyl] 2-acetyloxybenzoate has a molecular weight of 304.73 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(chloromethyl)phenyl] 2-acetyloxybenzoate is sourced from PubChem (CID 10859700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).