About 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane
2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane (PubChem CID 174970896) has the molecular formula C21H23ClO6
and a molecular weight of 406.86 g/mol. Its IUPAC name is 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane.
Molecular Properties
| Compound Name | 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane |
| PubChem CID | 174970896 |
| Molecular Formula | C21H23ClO6 |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane |
| SMILES | CC(=O)Oc1ccccc1C(=O)Oc1ccccc1C(=O)O.CCCCCCl |
| InChI | InChI=1S/C16H12O6.C5H11Cl/c1-10(17)21-14-9-5-3-7-12(14)16(20)22-13-8-4-2-6-11(13)15(18)19;1-2-3-4-5-6/h2-9H,1H3,(H,18,19);2-5H2,1H3 |
| InChIKey | WFVZCJOAUZLXKK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane?
The IUPAC name of 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane (CID 174970896) is 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane.
What is the SMILES notation for 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane?
The canonical SMILES for 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane is CC(=O)Oc1ccccc1C(=O)Oc1ccccc1C(=O)O.CCCCCCl.
What is the InChIKey of 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane?
The InChIKey is WFVZCJOAUZLXKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O6.C5H11Cl/c1-10(17)21-14-9-5-3-7-12(14)16(20)22-13-8-4-2-6-11(13)15(18)19;1-2-3-4-5-6/h2-9H,1H3,(H,18,19);2-5H2,1H3.
What are the key properties of 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane?
2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane has a molecular weight of 406.86 g/mol, XLogP of 4.94, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-acetyloxybenzoyl)oxybenzoic acid;1-chloropentane is sourced from PubChem (CID 174970896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).