C33H27NO7S3 — CID 90323519
[6-[(2S)-1-oxo-1-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]propan-2-yl]naphthalen-2-yl] 4-(2-nitrooxybutyl)benzoate (PubChem CID 90323519) has the molecular formula C33H27NO7S3 and a molecular weight of 645.78 g/mol. Its IUPAC name is [6-[(2S)-1-oxo-1-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]propan-2-yl]naphthalen-2-yl] 4-(2-nitrooxybutyl)benzoate.
| Compound Name | [6-[(2S)-1-oxo-1-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]propan-2-yl]naphthalen-2-yl] 4-(2-nitrooxybutyl)benzoate |
|---|---|
| PubChem CID | 90323519 |
| Molecular Formula | C33H27NO7S3 |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.09 |
| IUPAC Name | [6-[(2S)-1-oxo-1-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]propan-2-yl]naphthalen-2-yl] 4-(2-nitrooxybutyl)benzoate |
| SMILES | CCC(Cc1ccc(C(=O)Oc2ccc3cc([C@H](C)C(=O)Oc4ccc(-c5cc(=S)ss5)cc4)ccc3c2)cc1)O[N+](=O)[O-] |
| InChI | InChI=1S/C33H27NO7S3/c1-3-27(41-34(37)38)16-21-4-6-23(7-5-21)33(36)40-29-15-12-25-17-24(8-9-26(25)18-29)20(2)32(35)39-28-13-10-22(11-14-28)30-19-31(42)44-43-30/h4-15,17-20,27H,3,16H2,1-2H3/t20-,27?/m0/s1 |
| InChIKey | CWYNQKHCYMYLKW-SVQMELKDSA-N |
| XLogP | 8.82 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|