C35H36FN2O9PS3 — CID 90323629
[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]-1-[2-[4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenoxy]-2-oxoethyl]inden-5-yl] 3-nitrooxypentanoate (PubChem CID 90323629) has the molecular formula C35H36FN2O9PS3 and a molecular weight of 774.85 g/mol. Its IUPAC name is [(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]-1-[2-[4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenoxy]-2-oxoethyl]inden-5-yl] 3-nitrooxypentanoate.
| Compound Name | [(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]-1-[2-[4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenoxy]-2-oxoethyl]inden-5-yl] 3-nitrooxypentanoate |
|---|---|
| PubChem CID | 90323629 |
| Molecular Formula | C35H36FN2O9PS3 |
| Molecular Weight | 774.85 g/mol |
| Exact Mass | 774.13 |
| IUPAC Name | [(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]-1-[2-[4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenoxy]-2-oxoethyl]inden-5-yl] 3-nitrooxypentanoate |
| SMILES | CCC(CC(=O)Oc1cc2c(cc1F)C(CC(=O)Oc1ccc(P(=S)(S)N3CCOCC3)cc1)=C(C)/C2=C/c1ccc(S(C)=O)cc1)O[N+](=O)[O-] |
| InChI | InChI=1S/C35H36FN2O9PS3/c1-4-24(47-38(41)42)18-34(39)46-33-20-31-28(17-23-5-11-27(12-6-23)51(3)43)22(2)29(30(31)19-32(33)36)21-35(40)45-25-7-9-26(10-8-25)48(49,50)37-13-15-44-16-14-37/h5-12,17,19-20,24H,4,13-16,18,21H2,1-3H3,(H,49,50)/b28-17- |
| InChIKey | ONORCCJQZLJKRJ-QRQIAZFYSA-N |
| XLogP | 6.37 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.85 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|